About 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile
1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile (PubChem CID 160656807) has the molecular formula C24H31N5
and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile.
Molecular Properties
| Compound Name | 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile |
| PubChem CID | 160656807 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile |
| SMILES | [C-]#[N+]CCCCC#N.[C-]#[N+]CCCCCCCCC#N.[C-]#[N+]c1ccc(C)cc1 |
| InChI | InChI=1S/C10H16N2.C8H7N.C6H8N2/c1-12-10-8-6-4-2-3-5-7-9-11;1-7-3-5-8(9-2)6-4-7;1-8-6-4-2-3-5-7/h2-8,10H2;3-6H,1H3;2-4,6H2 |
| InChIKey | RLDSWDYARYJHKR-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile?
The IUPAC name of 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile (CID 160656807) is 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile.
What is the SMILES notation for 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile?
The canonical SMILES for 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile is [C-]#[N+]CCCCC#N.[C-]#[N+]CCCCCCCCC#N.[C-]#[N+]c1ccc(C)cc1.
What is the InChIKey of 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile?
The InChIKey is RLDSWDYARYJHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C8H7N.C6H8N2/c1-12-10-8-6-4-2-3-5-7-9-11;1-7-3-5-8(9-2)6-4-7;1-8-6-4-2-3-5-7/h2-8,10H2;3-6H,1H3;2-4,6H2.
What are the key properties of 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile?
1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile has a molecular weight of 389.55 g/mol, XLogP of 7.31, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-4-methylbenzene;9-isocyanononanenitrile;5-isocyanopentanenitrile is sourced from PubChem (CID 160656807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).