About (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid
(4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid (PubChem CID 160657679) has the molecular formula C9H14O3S2
and a molecular weight of 234.34 g/mol. Its IUPAC name is (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid |
| PubChem CID | 160657679 |
| Molecular Formula | C9H14O3S2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid |
| SMILES | CC1(C)CSSC[C@@H](C(=O)O)CC1=O |
| InChI | InChI=1S/C9H14O3S2/c1-9(2)5-14-13-4-6(8(11)12)3-7(9)10/h6H,3-5H2,1-2H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | RLGMCJOAXNSNOC-LURJTMIESA-N |
| XLogP | 2.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid?
The IUPAC name of (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid (CID 160657679) is (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid.
What is the SMILES notation for (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid?
The canonical SMILES for (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid is CC1(C)CSSC[C@@H](C(=O)O)CC1=O.
What is the InChIKey of (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid?
The InChIKey is RLGMCJOAXNSNOC-LURJTMIESA-N. The full InChI is InChI=1S/C9H14O3S2/c1-9(2)5-14-13-4-6(8(11)12)3-7(9)10/h6H,3-5H2,1-2H3,(H,11,12)/t6-/m0/s1.
What are the key properties of (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid?
(4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid has a molecular weight of 234.34 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-7,7-dimethyl-6-oxodithiocane-4-carboxylic acid is sourced from PubChem (CID 160657679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).