C24H21N3O5S — CID 160659946
5-[2-[6-(methylcarbamoyl)-1H-benzimidazol-2-yl]-2-oxoethyl]-2-(4-methylphenyl)benzenesulfonic acid (PubChem CID 160659946) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 5-[2-[6-(methylcarbamoyl)-1H-benzimidazol-2-yl]-2-oxoethyl]-2-(4-methylphenyl)benzenesulfonic acid.
| Compound Name | 5-[2-[6-(methylcarbamoyl)-1H-benzimidazol-2-yl]-2-oxoethyl]-2-(4-methylphenyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 160659946 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 5-[2-[6-(methylcarbamoyl)-1H-benzimidazol-2-yl]-2-oxoethyl]-2-(4-methylphenyl)benzenesulfonic acid |
| SMILES | CNC(=O)c1ccc2nc(C(=O)Cc3ccc(-c4ccc(C)cc4)c(S(=O)(=O)O)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H21N3O5S/c1-14-3-6-16(7-4-14)18-9-5-15(12-22(18)33(30,31)32)11-21(28)23-26-19-10-8-17(24(29)25-2)13-20(19)27-23/h3-10,12-13H,11H2,1-2H3,(H,25,29)(H,26,27)(H,30,31,32) |
| InChIKey | IOPXZDRRGLSFEW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|