C31H25F3N2O+2 — CID 160663783
17,17-dimethyl-5-(2-methylphenyl)-14-[2-(trifluoromethoxy)phenyl]-5,14-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene (PubChem CID 160663783) has the molecular formula C31H25F3N2O+2 and a molecular weight of 498.55 g/mol. Its IUPAC name is 17,17-dimethyl-5-(2-methylphenyl)-14-[2-(trifluoromethoxy)phenyl]-5,14-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene.
| Compound Name | 17,17-dimethyl-5-(2-methylphenyl)-14-[2-(trifluoromethoxy)phenyl]-5,14-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
|---|---|
| PubChem CID | 160663783 |
| Molecular Formula | C31H25F3N2O+2 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 17,17-dimethyl-5-(2-methylphenyl)-14-[2-(trifluoromethoxy)phenyl]-5,14-diazoniatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,8,11(16),12,14-octaene |
| SMILES | Cc1ccccc1-[n+]1ccc2c3c(ccc2c1)-c1cc[n+](-c2ccccc2OC(F)(F)F)cc1C3(C)C |
| InChI | InChI=1S/C31H25F3N2O/c1-20-8-4-5-9-26(20)35-16-14-22-21(18-35)12-13-24-23-15-17-36(19-25(23)30(2,3)29(22)24)27-10-6-7-11-28(27)37-31(32,33)34/h4-19H,1-3H3/q+2 |
| InChIKey | FJNBMJIBNYFYCU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 16.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|