C22H28BN3O2 — CID 160664878
(3R,5S)-4-(10-hydroxy-11-propyl-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol (PubChem CID 160664878) has the molecular formula C22H28BN3O2 and a molecular weight of 377.30 g/mol. Its IUPAC name is (3R,5S)-4-(10-hydroxy-11-propyl-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol.
| Compound Name | (3R,5S)-4-(10-hydroxy-11-propyl-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
|---|---|
| PubChem CID | 160664878 |
| Molecular Formula | C22H28BN3O2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (3R,5S)-4-(10-hydroxy-11-propyl-7,11,12-triaza-10-boratricyclo[7.4.0.02,6]trideca-1,3,6,8,12-pentaen-13-yl)adamantan-1-ol |
| SMILES | CCCN1N=C(C2[C@@H]3CC4C[C@H]2CC(O)(C4)C3)c2c(cnc3c2C=CC3)B1O |
| InChI | InChI=1S/C22H28BN3O2/c1-2-6-26-23(28)17-12-24-18-5-3-4-16(18)20(17)21(25-26)19-14-7-13-8-15(19)11-22(27,9-13)10-14/h3-4,12-15,19,27-28H,2,5-11H2,1H3/t13?,14-,15+,19?,22? |
| InChIKey | PEJHQCRSLHJILK-MRCPVMOPSA-N |
| XLogP | 1.96 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|