About 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen
1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen (PubChem CID 160667745) has the molecular formula C16H30N2O7
and a molecular weight of 362.42 g/mol. Its IUPAC name is 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen |
| PubChem CID | 160667745 |
| Molecular Formula | C16H30N2O7 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen |
| SMILES | CCCOC(=O)C(CCCC(C)(C)[N+](=O)[O-])(NC(C)=O)C(=O)OCC.[H][H] |
| InChI | InChI=1S/C16H28N2O7.H2/c1-6-11-25-14(21)16(17-12(3)19,13(20)24-7-2)10-8-9-15(4,5)18(22)23;/h6-11H2,1-5H3,(H,17,19);1H |
| InChIKey | RMNMGDMYQGKHEL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen?
The IUPAC name of 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen (CID 160667745) is 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen.
What is the SMILES notation for 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen?
The canonical SMILES for 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen is CCCOC(=O)C(CCCC(C)(C)[N+](=O)[O-])(NC(C)=O)C(=O)OCC.[H][H].
What is the InChIKey of 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen?
The InChIKey is RMNMGDMYQGKHEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O7.H2/c1-6-11-25-14(21)16(17-12(3)19,13(20)24-7-2)10-8-9-15(4,5)18(22)23;/h6-11H2,1-5H3,(H,17,19);1H.
What are the key properties of 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen?
1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen has a molecular weight of 362.42 g/mol, XLogP of 1.85, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-propyl 2-acetamido-2-(4-methyl-4-nitropentyl)propanedioate;molecular hydrogen is sourced from PubChem (CID 160667745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).