C22H30B2F3NO7 — CID 160668139
2-methoxyacetic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;phenylboronic acid (PubChem CID 160668139) has the molecular formula C22H30B2F3NO7 and a molecular weight of 499.10 g/mol. Its IUPAC name is 2-methoxyacetic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;phenylboronic acid.
| Compound Name | 2-methoxyacetic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;phenylboronic acid |
|---|---|
| PubChem CID | 160668139 |
| Molecular Formula | C22H30B2F3NO7 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 2-methoxyacetic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;phenylboronic acid |
| SMILES | COCC(=O)O.Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C(F)(F)F)n1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C13H17BF3NO2.C6H7BO2.C3H6O3/c1-8-6-9(7-10(18-8)13(15,16)17)14-19-11(2,3)12(4,5)20-14;8-7(9)6-4-2-1-3-5-6;1-6-2-3(4)5/h6-7H,1-5H3;1-5,8-9H;2H2,1H3,(H,4,5) |
| InChIKey | RMOSSBWVKWCOEL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|