C12H18F2N2 — CID 160668446
3-(4a,5,6,7,8,8a-hexahydroquinolin-2-yl)-2,2-difluoropropan-1-amine (PubChem CID 160668446) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(4a,5,6,7,8,8a-hexahydroquinolin-2-yl)-2,2-difluoropropan-1-amine.
| Compound Name | 3-(4a,5,6,7,8,8a-hexahydroquinolin-2-yl)-2,2-difluoropropan-1-amine |
|---|---|
| PubChem CID | 160668446 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-(4a,5,6,7,8,8a-hexahydroquinolin-2-yl)-2,2-difluoropropan-1-amine |
| SMILES | NCC(F)(F)CC1=NC2CCCCC2C=C1 |
| InChI | InChI=1S/C12H18F2N2/c13-12(14,8-15)7-10-6-5-9-3-1-2-4-11(9)16-10/h5-6,9,11H,1-4,7-8,15H2 |
| InChIKey | FYVODSUHUVJRAU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |