C22H16BrFN2O3 — CID 160668525
3-[(2-bromo-3-pyridinyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one;2-fluoro-5-formylbenzonitrile (PubChem CID 160668525) has the molecular formula C22H16BrFN2O3 and a molecular weight of 455.28 g/mol. Its IUPAC name is 3-[(2-bromo-3-pyridinyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one;2-fluoro-5-formylbenzonitrile.
| Compound Name | 3-[(2-bromo-3-pyridinyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one;2-fluoro-5-formylbenzonitrile |
|---|---|
| PubChem CID | 160668525 |
| Molecular Formula | C22H16BrFN2O3 |
| Molecular Weight | 455.28 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 3-[(2-bromo-3-pyridinyl)methylidene]-4,5,6,7-tetrahydro-2-benzofuran-1-one;2-fluoro-5-formylbenzonitrile |
| SMILES | N#Cc1cc(C=O)ccc1F.O=C1OC(=Cc2cccnc2Br)C2=C1CCCC2 |
| InChI | InChI=1S/C14H12BrNO2.C8H4FNO/c15-13-9(4-3-7-16-13)8-12-10-5-1-2-6-11(10)14(17)18-12;9-8-2-1-6(5-11)3-7(8)4-10/h3-4,7-8H,1-2,5-6H2;1-3,5H |
| InChIKey | RMPYZYLGCLSPOV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|