C6Cl12 — CID 160669279
1,1,2,3,4,4-hexachlorobuta-1,3-diene;1,1,1,2,2,2-hexachloroethane (PubChem CID 160669279) has the molecular formula C6Cl12 and a molecular weight of 497.50 g/mol. Its IUPAC name is 1,1,2,3,4,4-hexachlorobuta-1,3-diene;1,1,1,2,2,2-hexachloroethane.
| Compound Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;1,1,1,2,2,2-hexachloroethane |
|---|---|
| PubChem CID | 160669279 |
| Molecular Formula | C6Cl12 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 491.63 |
| IUPAC Name | 1,1,2,3,4,4-hexachlorobuta-1,3-diene;1,1,1,2,2,2-hexachloroethane |
| SMILES | ClC(Cl)(Cl)C(Cl)(Cl)Cl.ClC(Cl)=C(Cl)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C4Cl6.C2Cl6/c5-1(3(7)8)2(6)4(9)10;3-1(4,5)2(6,7)8 |
| InChIKey | RMSFKXMTAQSMHY-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|