About dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile
dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile (PubChem CID 160669385) has the molecular formula C16H26N2O6
and a molecular weight of 342.39 g/mol. Its IUPAC name is dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile.
Molecular Properties
| Compound Name | dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile |
| PubChem CID | 160669385 |
| Molecular Formula | C16H26N2O6 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile |
| SMILES | COC(=O)CC(CC#N)CC(=O)OC.N#CCC(CCO)CCO |
| InChI | InChI=1S/C9H13NO4.C7H13NO2/c1-13-8(11)5-7(3-4-10)6-9(12)14-2;8-4-1-7(2-5-9)3-6-10/h7H,3,5-6H2,1-2H3;7,9-10H,1-3,5-6H2 |
| InChIKey | RMSPFOGGTBZLND-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile?
The IUPAC name of dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile (CID 160669385) is dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile.
What is the SMILES notation for dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile?
The canonical SMILES for dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile is COC(=O)CC(CC#N)CC(=O)OC.N#CCC(CCO)CCO.
What is the InChIKey of dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile?
The InChIKey is RMSPFOGGTBZLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4.C7H13NO2/c1-13-8(11)5-7(3-4-10)6-9(12)14-2;8-4-1-7(2-5-9)3-6-10/h7H,3,5-6H2,1-2H3;7,9-10H,1-3,5-6H2.
What are the key properties of dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile?
dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile has a molecular weight of 342.39 g/mol, XLogP of 0.92, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-(cyanomethyl)pentanedioate;5-hydroxy-3-(2-hydroxyethyl)pentanenitrile is sourced from PubChem (CID 160669385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).