About 9H-pyrrolo[1,2-b][2]benzazepine
9H-pyrrolo[1,2-b][2]benzazepine (PubChem CID 160669887) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 9H-pyrrolo[1,2-b][2]benzazepine.
Molecular Properties
| Compound Name | 9H-pyrrolo[1,2-b][2]benzazepine |
| PubChem CID | 160669887 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 9H-pyrrolo[1,2-b][2]benzazepine |
| SMILES | C1=CC2=CC=c3ccccc3=CN2C1 |
| InChI | InChI=1S/C13H11N/c1-2-5-12-10-14-9-3-6-13(14)8-7-11(12)4-1/h1-8,10H,9H2 |
| InChIKey | MGRXBNKCKMNVOU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-pyrrolo[1,2-b][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrrolo[1,2-b][2]benzazepine?
The IUPAC name of 9H-pyrrolo[1,2-b][2]benzazepine (CID 160669887) is 9H-pyrrolo[1,2-b][2]benzazepine.
What is the SMILES notation for 9H-pyrrolo[1,2-b][2]benzazepine?
The canonical SMILES for 9H-pyrrolo[1,2-b][2]benzazepine is C1=CC2=CC=c3ccccc3=CN2C1.
What is the InChIKey of 9H-pyrrolo[1,2-b][2]benzazepine?
The InChIKey is MGRXBNKCKMNVOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-2-5-12-10-14-9-3-6-13(14)8-7-11(12)4-1/h1-8,10H,9H2.
What are the key properties of 9H-pyrrolo[1,2-b][2]benzazepine?
9H-pyrrolo[1,2-b][2]benzazepine has a molecular weight of 181.24 g/mol, XLogP of 0.97, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrrolo[1,2-b][2]benzazepine is sourced from PubChem (CID 160669887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).