C15H28F2N2O4 — CID 160670164
tert-butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate;3-fluoropiperidin-4-ol (PubChem CID 160670164) has the molecular formula C15H28F2N2O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is tert-butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate;3-fluoropiperidin-4-ol.
| Compound Name | tert-butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate;3-fluoropiperidin-4-ol |
|---|---|
| PubChem CID | 160670164 |
| Molecular Formula | C15H28F2N2O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | tert-butyl 3-fluoro-4-hydroxypiperidine-1-carboxylate;3-fluoropiperidin-4-ol |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C(F)C1.OC1CCNCC1F |
| InChI | InChI=1S/C10H18FNO3.C5H10FNO/c1-10(2,3)15-9(14)12-5-4-8(13)7(11)6-12;6-4-3-7-2-1-5(4)8/h7-8,13H,4-6H2,1-3H3;4-5,7-8H,1-3H2 |
| InChIKey | RMVCUHBVXZRBMW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |