About (E)-2-ethyl-8-phenylnon-4-enenitrile;methane
(E)-2-ethyl-8-phenylnon-4-enenitrile;methane (PubChem CID 160671752) has the molecular formula C23H47N
and a molecular weight of 337.64 g/mol. Its IUPAC name is (E)-2-ethyl-8-phenylnon-4-enenitrile;methane.
Molecular Properties
| Compound Name | (E)-2-ethyl-8-phenylnon-4-enenitrile;methane |
| PubChem CID | 160671752 |
| Molecular Formula | C23H47N |
| Molecular Weight | 337.64 g/mol |
| Exact Mass | 337.37 |
| IUPAC Name | (E)-2-ethyl-8-phenylnon-4-enenitrile;methane |
| SMILES | C.C.C.C.C.C.CCC(C#N)C/C=C/CCC(C)c1ccccc1 |
| InChI | InChI=1S/C17H23N.6CH4/c1-3-16(14-18)11-7-4-6-10-15(2)17-12-8-5-9-13-17;;;;;;/h4-5,7-9,12-13,15-16H,3,6,10-11H2,1-2H3;6*1H4/b7-4+;;;;;; |
| InChIKey | RNAAVKMILPLQGB-IFAMVKFDSA-N |
| XLogP | 8.88 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.64 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethyl-8-phenylnon-4-enenitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethyl-8-phenylnon-4-enenitrile;methane?
The IUPAC name of (E)-2-ethyl-8-phenylnon-4-enenitrile;methane (CID 160671752) is (E)-2-ethyl-8-phenylnon-4-enenitrile;methane.
What is the SMILES notation for (E)-2-ethyl-8-phenylnon-4-enenitrile;methane?
The canonical SMILES for (E)-2-ethyl-8-phenylnon-4-enenitrile;methane is C.C.C.C.C.C.CCC(C#N)C/C=C/CCC(C)c1ccccc1.
What is the InChIKey of (E)-2-ethyl-8-phenylnon-4-enenitrile;methane?
The InChIKey is RNAAVKMILPLQGB-IFAMVKFDSA-N. The full InChI is InChI=1S/C17H23N.6CH4/c1-3-16(14-18)11-7-4-6-10-15(2)17-12-8-5-9-13-17;;;;;;/h4-5,7-9,12-13,15-16H,3,6,10-11H2,1-2H3;6*1H4/b7-4+;;;;;;.
What are the key properties of (E)-2-ethyl-8-phenylnon-4-enenitrile;methane?
(E)-2-ethyl-8-phenylnon-4-enenitrile;methane has a molecular weight of 337.64 g/mol, XLogP of 8.88, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethyl-8-phenylnon-4-enenitrile;methane is sourced from PubChem (CID 160671752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).