C42H48O12 — CID 160674040
4-(4-carboxycyclohexyl)benzoic acid;4-(4-carboxycyclohexyl)cyclohexane-1-carboxylic acid;4-(4-carboxyphenyl)benzoic acid (PubChem CID 160674040) has the molecular formula C42H48O12 and a molecular weight of 744.83 g/mol. Its IUPAC name is 4-(4-carboxycyclohexyl)benzoic acid;4-(4-carboxycyclohexyl)cyclohexane-1-carboxylic acid;4-(4-carboxyphenyl)benzoic acid.
| Compound Name | 4-(4-carboxycyclohexyl)benzoic acid;4-(4-carboxycyclohexyl)cyclohexane-1-carboxylic acid;4-(4-carboxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 160674040 |
| Molecular Formula | C42H48O12 |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.31 |
| IUPAC Name | 4-(4-carboxycyclohexyl)benzoic acid;4-(4-carboxycyclohexyl)cyclohexane-1-carboxylic acid;4-(4-carboxyphenyl)benzoic acid |
| SMILES | O=C(O)C1CCC(C2CCC(C(=O)O)CC2)CC1.O=C(O)c1ccc(-c2ccc(C(=O)O)cc2)cc1.O=C(O)c1ccc(C2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C14H22O4.C14H16O4.C14H10O4/c3*15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h9-12H,1-8H2,(H,15,16)(H,17,18);1-2,5-6,10,12H,3-4,7-8H2,(H,15,16)(H,17,18);1-8H,(H,15,16)(H,17,18) |
| InChIKey | RNHKUBFKMXTVQC-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |