C20H24FLiN2O2S — CID 160674052
lithium;butane;[1-(4-fluorobenzoyl)piperidin-4-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 160674052) has the molecular formula C20H24FLiN2O2S and a molecular weight of 382.43 g/mol. Its IUPAC name is lithium;butane;[1-(4-fluorobenzoyl)piperidin-4-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | lithium;butane;[1-(4-fluorobenzoyl)piperidin-4-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 160674052 |
| Molecular Formula | C20H24FLiN2O2S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | lithium;butane;[1-(4-fluorobenzoyl)piperidin-4-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)C1CCN(C(=O)c2ccc(F)cc2)CC1.[CH2-]CCC.[Li+] |
| InChI | InChI=1S/C16H15FN2O2S.C4H9.Li/c17-13-3-1-12(2-4-13)16(21)19-8-5-11(6-9-19)14(20)15-18-7-10-22-15;1-3-4-2;/h1-4,7,10-11H,5-6,8-9H2;1,3-4H2,2H3;/q;-1;+1 |
| InChIKey | ZWMCXLHOBSJQMC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|