C20H22IN3 — CID 160675165
iodomethane;1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline-7-carbonitrile (PubChem CID 160675165) has the molecular formula C20H22IN3 and a molecular weight of 431.32 g/mol. Its IUPAC name is iodomethane;1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline-7-carbonitrile.
| Compound Name | iodomethane;1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 160675165 |
| Molecular Formula | C20H22IN3 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | iodomethane;1-(1-pyridin-2-ylcyclobutyl)-1,2,3,4-tetrahydroisoquinoline-7-carbonitrile |
| SMILES | CI.N#Cc1ccc2c(c1)C(C1(c3ccccn3)CCC1)NCC2 |
| InChI | InChI=1S/C19H19N3.CH3I/c20-13-14-5-6-15-7-11-22-18(16(15)12-14)19(8-3-9-19)17-4-1-2-10-21-17;1-2/h1-2,4-6,10,12,18,22H,3,7-9,11H2;1H3 |
| InChIKey | RNKZUNSFUNQYIV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|