C22H28F2N2 — CID 160676935
1-butylpiperidine;3,3-difluoro-2H-acridine (PubChem CID 160676935) has the molecular formula C22H28F2N2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 1-butylpiperidine;3,3-difluoro-2H-acridine.
| Compound Name | 1-butylpiperidine;3,3-difluoro-2H-acridine |
|---|---|
| PubChem CID | 160676935 |
| Molecular Formula | C22H28F2N2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1-butylpiperidine;3,3-difluoro-2H-acridine |
| SMILES | CCCCN1CCCCC1.FC1(F)C=c2nc3ccccc3cc2=CC1 |
| InChI | InChI=1S/C13H9F2N.C9H19N/c14-13(15)6-5-10-7-9-3-1-2-4-11(9)16-12(10)8-13;1-2-3-7-10-8-5-4-6-9-10/h1-5,7-8H,6H2;2-9H2,1H3 |
| InChIKey | RNQPIWGIVTZADD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |