C67H57N3Si2 — CID 160679461
2-N',5-N',12'-triphenyl-2-N',5-N'-bis(3-trimethylsilylphenyl)spiro[fluorene-9,7'-indeno[1,2-a]carbazole]-2',5'-diamine (PubChem CID 160679461) has the molecular formula C67H57N3Si2 and a molecular weight of 960.39 g/mol. Its IUPAC name is 2-N',5-N',12'-triphenyl-2-N',5-N'-bis(3-trimethylsilylphenyl)spiro[fluorene-9,7'-indeno[1,2-a]carbazole]-2',5'-diamine.
| Compound Name | 2-N',5-N',12'-triphenyl-2-N',5-N'-bis(3-trimethylsilylphenyl)spiro[fluorene-9,7'-indeno[1,2-a]carbazole]-2',5'-diamine |
|---|---|
| PubChem CID | 160679461 |
| Molecular Formula | C67H57N3Si2 |
| Molecular Weight | 960.39 g/mol |
| Exact Mass | 959.41 |
| IUPAC Name | 2-N',5-N',12'-triphenyl-2-N',5-N'-bis(3-trimethylsilylphenyl)spiro[fluorene-9,7'-indeno[1,2-a]carbazole]-2',5'-diamine |
| SMILES | C[Si](C)(C)c1cccc(N(c2ccccc2)c2ccc3c4c(N(c5ccccc5)c5cccc([Si](C)(C)C)c5)cc5c(c4n(-c4ccccc4)c3c2)-c2ccccc2C52c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C67H57N3Si2/c1-71(2,3)52-32-22-30-49(42-52)68(46-24-10-7-11-25-46)51-40-41-57-62(44-51)70(48-28-14-9-15-29-48)66-64-56-36-18-21-39-60(56)67(58-37-19-16-34-54(58)55-35-17-20-38-59(55)67)61(64)45-63(65(57)66)69(47-26-12-8-13-27-47)50-31-23-33-53(43-50)72(4,5)6/h7-45H,1-6H3 |
| InChIKey | AOSDEVVKIOWXFX-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.39 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|