C20H32O6Ti — CID 160679499
butanoate;titanium(4+);1,2,5-trimethylcyclopenta-1,3-diene (PubChem CID 160679499) has the molecular formula C20H32O6Ti and a molecular weight of 416.34 g/mol. Its IUPAC name is butanoate;titanium(4+);1,2,5-trimethylcyclopenta-1,3-diene.
| Compound Name | butanoate;titanium(4+);1,2,5-trimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 160679499 |
| Molecular Formula | C20H32O6Ti |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | butanoate;titanium(4+);1,2,5-trimethylcyclopenta-1,3-diene |
| SMILES | CCCC(=O)[O-].CCCC(=O)[O-].CCCC(=O)[O-].Cc1cc[c-](C)c1C.[Ti+4] |
| InChI | InChI=1S/C8H11.3C4H8O2.Ti/c1-6-4-5-7(2)8(6)3;3*1-2-3-4(5)6;/h4-5H,1-3H3;3*2-3H2,1H3,(H,5,6);/q-1;;;;+4/p-3 |
| InChIKey | OROMSCWNPSICKU-UHFFFAOYSA-K |
| XLogP | 0.94 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|