About 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide
2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide (PubChem CID 160680112) has the molecular formula C22H28ClNO2
and a molecular weight of 373.92 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide |
| PubChem CID | 160680112 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide |
| SMILES | CON(C)C(=O)C(C)(C)c1ccc(-c2ccccc2CCCCCl)cc1 |
| InChI | InChI=1S/C22H28ClNO2/c1-22(2,21(25)24(3)26-4)19-14-12-18(13-15-19)20-11-6-5-9-17(20)10-7-8-16-23/h5-6,9,11-15H,7-8,10,16H2,1-4H3 |
| InChIKey | ROALOPDAFYQENN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide?
The IUPAC name of 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide (CID 160680112) is 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide.
What is the SMILES notation for 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide?
The canonical SMILES for 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide is CON(C)C(=O)C(C)(C)c1ccc(-c2ccccc2CCCCCl)cc1.
What is the InChIKey of 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide?
The InChIKey is ROALOPDAFYQENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClNO2/c1-22(2,21(25)24(3)26-4)19-14-12-18(13-15-19)20-11-6-5-9-17(20)10-7-8-16-23/h5-6,9,11-15H,7-8,10,16H2,1-4H3.
What are the key properties of 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide?
2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide has a molecular weight of 373.92 g/mol, XLogP of 5.21, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(4-chlorobutyl)phenyl]phenyl]-N-methoxy-N,2-dimethylpropanamide is sourced from PubChem (CID 160680112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).