About 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran
4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran (PubChem CID 160680307) has the molecular formula C15H14OS
and a molecular weight of 242.34 g/mol. Its IUPAC name is 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran.
Molecular Properties
| Compound Name | 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran |
| PubChem CID | 160680307 |
| Molecular Formula | C15H14OS |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran |
| SMILES | C=C(C)c1cc2c(C)c3ccsc3c(C)c2o1 |
| InChI | InChI=1S/C15H14OS/c1-8(2)13-7-12-9(3)11-5-6-17-15(11)10(4)14(12)16-13/h5-7H,1H2,2-4H3 |
| InChIKey | JJFQCBIKSCCHFY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran?
The IUPAC name of 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran (CID 160680307) is 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran.
What is the SMILES notation for 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran?
The canonical SMILES for 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran is C=C(C)c1cc2c(C)c3ccsc3c(C)c2o1.
What is the InChIKey of 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran?
The InChIKey is JJFQCBIKSCCHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14OS/c1-8(2)13-7-12-9(3)11-5-6-17-15(11)10(4)14(12)16-13/h5-7H,1H2,2-4H3.
What are the key properties of 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran?
4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran has a molecular weight of 242.34 g/mol, XLogP of 5.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dimethyl-2-prop-1-en-2-ylthieno[3,2-f][1]benzofuran is sourced from PubChem (CID 160680307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).