C30H34ClN5O4 — CID 160685607
7-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]-6-oxoheptanoic acid (PubChem CID 160685607) has the molecular formula C30H34ClN5O4 and a molecular weight of 564.09 g/mol. Its IUPAC name is 7-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]-6-oxoheptanoic acid.
| Compound Name | 7-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 160685607 |
| Molecular Formula | C30H34ClN5O4 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 7-[4-[2-amino-8-[(4-chlorophenyl)methoxy]-5,6-dihydrobenzo[h]quinazolin-4-yl]piperazin-1-yl]-6-oxoheptanoic acid |
| SMILES | Nc1nc2c(c(N3CCN(CC(=O)CCCCC(=O)O)CC3)n1)CCc1cc(OCc3ccc(Cl)cc3)ccc1-2 |
| InChI | InChI=1S/C30H34ClN5O4/c31-22-8-5-20(6-9-22)19-40-24-10-12-25-21(17-24)7-11-26-28(25)33-30(32)34-29(26)36-15-13-35(14-16-36)18-23(37)3-1-2-4-27(38)39/h5-6,8-10,12,17H,1-4,7,11,13-16,18-19H2,(H,38,39)(H2,32,33,34) |
| InChIKey | ROSKGGDQBJBLOV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|