C18H23NO6 — CID 160686347
carbon dioxide;methyl (E)-2-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-3,4-dimethylpent-2-enoate (PubChem CID 160686347) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is carbon dioxide;methyl (E)-2-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-3,4-dimethylpent-2-enoate.
| Compound Name | carbon dioxide;methyl (E)-2-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-3,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 160686347 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | carbon dioxide;methyl (E)-2-[[4-(2-amino-2-oxoethoxy)phenyl]methyl]-3,4-dimethylpent-2-enoate |
| SMILES | COC(=O)/C(Cc1ccc(OCC(N)=O)cc1)=C(\C)C(C)C.O=C=O |
| InChI | InChI=1S/C17H23NO4.CO2/c1-11(2)12(3)15(17(20)21-4)9-13-5-7-14(8-6-13)22-10-16(18)19;2-1-3/h5-8,11H,9-10H2,1-4H3,(H2,18,19);/b15-12+; |
| InChIKey | ROUSRJYFWANNLN-JRUHLWALSA-N |
| XLogP | 1.66 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|