C32H29F8IN4O2 — CID 160687082
5-ethynyl-3-fluoro-1-(oxan-2-yl)indazole;3-fluoro-1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole;1,1,1-trifluoro-2-iodoethane (PubChem CID 160687082) has the molecular formula C32H29F8IN4O2 and a molecular weight of 780.50 g/mol. Its IUPAC name is 5-ethynyl-3-fluoro-1-(oxan-2-yl)indazole;3-fluoro-1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole;1,1,1-trifluoro-2-iodoethane.
| Compound Name | 5-ethynyl-3-fluoro-1-(oxan-2-yl)indazole;3-fluoro-1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole;1,1,1-trifluoro-2-iodoethane |
|---|---|
| PubChem CID | 160687082 |
| Molecular Formula | C32H29F8IN4O2 |
| Molecular Weight | 780.50 g/mol |
| Exact Mass | 780.12 |
| IUPAC Name | 5-ethynyl-3-fluoro-1-(oxan-2-yl)indazole;3-fluoro-1-(oxan-2-yl)-5-(4,4,4-trifluorobut-1-ynyl)indazole;1,1,1-trifluoro-2-iodoethane |
| SMILES | C#Cc1ccc2c(c1)c(F)nn2C1CCCCO1.FC(F)(F)CI.Fc1nn(C2CCCCO2)c2ccc(C#CCC(F)(F)F)cc12 |
| InChI | InChI=1S/C16H14F4N2O.C14H13FN2O.C2H2F3I/c17-15-12-10-11(4-3-8-16(18,19)20)6-7-13(12)22(21-15)14-5-1-2-9-23-14;1-2-10-6-7-12-11(9-10)14(15)16-17(12)13-5-3-4-8-18-13;3-2(4,5)1-6/h6-7,10,14H,1-2,5,8-9H2;1,6-7,9,13H,3-5,8H2;1H2 |
| InChIKey | ROXFUPHICIBQST-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.50 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|