About 1,2-dimethylhydrazine;propan-2-one
1,2-dimethylhydrazine;propan-2-one (PubChem CID 160687322) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is 1,2-dimethylhydrazine;propan-2-one.
Molecular Properties
| Compound Name | 1,2-dimethylhydrazine;propan-2-one |
| PubChem CID | 160687322 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 1,2-dimethylhydrazine;propan-2-one |
| SMILES | CC(C)=O.CNNC |
| InChI | InChI=1S/C3H6O.C2H8N2/c1-3(2)4;1-3-4-2/h1-2H3;3-4H,1-2H3 |
| InChIKey | ROXYXGIFXBCYAB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylhydrazine;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylhydrazine;propan-2-one?
The IUPAC name of 1,2-dimethylhydrazine;propan-2-one (CID 160687322) is 1,2-dimethylhydrazine;propan-2-one.
What is the SMILES notation for 1,2-dimethylhydrazine;propan-2-one?
The canonical SMILES for 1,2-dimethylhydrazine;propan-2-one is CC(C)=O.CNNC.
What is the InChIKey of 1,2-dimethylhydrazine;propan-2-one?
The InChIKey is ROXYXGIFXBCYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H8N2/c1-3(2)4;1-3-4-2/h1-2H3;3-4H,1-2H3.
What are the key properties of 1,2-dimethylhydrazine;propan-2-one?
1,2-dimethylhydrazine;propan-2-one has a molecular weight of 118.18 g/mol, XLogP of -0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylhydrazine;propan-2-one is sourced from PubChem (CID 160687322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).