C35H45N3O7PSSi+ — CID 160687948
[(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate;triphenyl-[(E)-prop-1-enyl]phosphanium (PubChem CID 160687948) has the molecular formula C35H45N3O7PSSi+ and a molecular weight of 710.89 g/mol. Its IUPAC name is [(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate;triphenyl-[(E)-prop-1-enyl]phosphanium.
| Compound Name | [(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate;triphenyl-[(E)-prop-1-enyl]phosphanium |
|---|---|
| PubChem CID | 160687948 |
| Molecular Formula | C35H45N3O7PSSi+ |
| Molecular Weight | 710.89 g/mol |
| Exact Mass | 710.25 |
| IUPAC Name | [(2S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-carbamoyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate;triphenyl-[(E)-prop-1-enyl]phosphanium |
| SMILES | C/C=C/[P+](c1ccccc1)(c1ccccc1)c1ccccc1.CC(C)(C)[Si](C)(C)OC[C@@H]1C=C(C(N)=O)[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C21H20P.C14H25N3O7SSi/c1-2-18-22(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21;1-14(2,3)26(4,5)23-8-9-6-10(12(15)18)11-7-16(9)13(19)17(11)24-25(20,21)22/h2-18H,1H3;6,9,11H,7-8H2,1-5H3,(H2,15,18)(H,20,21,22)/q+1;/b18-2+;/t;9-,11-/m.0/s1 |
| InChIKey | RPABIYNNKCFYMH-XBAZDXRASA-N |
| XLogP | 5.16 |
| TPSA | 139.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.89 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|