About 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc
2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc (PubChem CID 160688399) has the molecular formula C15H14O2Zn
and a molecular weight of 291.66 g/mol. Its IUPAC name is 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc.
Molecular Properties
| Compound Name | 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc |
| PubChem CID | 160688399 |
| Molecular Formula | C15H14O2Zn |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc |
| SMILES | Oc1ccc2c(c1)CCC(c1ccccc1)O2.[Zn] |
| InChI | InChI=1S/C15H14O2.Zn/c16-13-7-9-15-12(10-13)6-8-14(17-15)11-4-2-1-3-5-11;/h1-5,7,9-10,14,16H,6,8H2; |
| InChIKey | RPBSHELJZQXFND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc?
The IUPAC name of 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc (CID 160688399) is 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc.
What is the SMILES notation for 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc?
The canonical SMILES for 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc is Oc1ccc2c(c1)CCC(c1ccccc1)O2.[Zn].
What is the InChIKey of 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc?
The InChIKey is RPBSHELJZQXFND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2.Zn/c16-13-7-9-15-12(10-13)6-8-14(17-15)11-4-2-1-3-5-11;/h1-5,7,9-10,14,16H,6,8H2;.
What are the key properties of 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc?
2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc has a molecular weight of 291.66 g/mol, XLogP of 3.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-3,4-dihydro-2H-chromen-6-ol;zinc is sourced from PubChem (CID 160688399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).