About 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane
3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane (PubChem CID 160689191) has the molecular formula C13H8Br6Cl4N2
and a molecular weight of 813.46 g/mol. Its IUPAC name is 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane.
Molecular Properties
| Compound Name | 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane |
| PubChem CID | 160689191 |
| Molecular Formula | C13H8Br6Cl4N2 |
| Molecular Weight | 813.46 g/mol |
| Exact Mass | 805.45 |
| IUPAC Name | 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane |
| SMILES | Brc1ccc(Br)c(C(Br)Br)n1.Cc1nc(Br)ccc1Br.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H3Br4N.C6H5Br2N.CCl4/c7-3-1-2-4(8)11-5(3)6(9)10;1-4-5(7)2-3-6(8)9-4;2-1(3,4)5/h1-2,6H;2-3H,1H3; |
| InChIKey | RPELRPMMCMIEAN-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 813.46 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane?
The IUPAC name of 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane (CID 160689191) is 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane.
What is the SMILES notation for 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane?
The canonical SMILES for 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane is Brc1ccc(Br)c(C(Br)Br)n1.Cc1nc(Br)ccc1Br.ClC(Cl)(Cl)Cl.
What is the InChIKey of 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane?
The InChIKey is RPELRPMMCMIEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br4N.C6H5Br2N.CCl4/c7-3-1-2-4(8)11-5(3)6(9)10;1-4-5(7)2-3-6(8)9-4;2-1(3,4)5/h1-2,6H;2-3H,1H3;.
What are the key properties of 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane?
3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane has a molecular weight of 813.46 g/mol, XLogP of 9.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromo-2-(dibromomethyl)pyridine;3,6-dibromo-2-methylpyridine;tetrachloromethane is sourced from PubChem (CID 160689191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).