About 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine
3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine (PubChem CID 160689562) has the molecular formula C4Cl3I2NOS
and a molecular weight of 470.28 g/mol. Its IUPAC name is 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine.
Molecular Properties
| Compound Name | 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine |
| PubChem CID | 160689562 |
| Molecular Formula | C4Cl3I2NOS |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 468.69 |
| IUPAC Name | 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine |
| SMILES | II.O=C(Cl)c1snc(Cl)c1Cl |
| InChI | InChI=1S/C4Cl3NOS.I2/c5-1-2(4(7)9)10-8-3(1)6;1-2 |
| InChIKey | RPFPLRLQNPJCSC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine?
The IUPAC name of 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine (CID 160689562) is 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine.
What is the SMILES notation for 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine?
The canonical SMILES for 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine is II.O=C(Cl)c1snc(Cl)c1Cl.
What is the InChIKey of 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine?
The InChIKey is RPFPLRLQNPJCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4Cl3NOS.I2/c5-1-2(4(7)9)10-8-3(1)6;1-2.
What are the key properties of 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine?
3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine has a molecular weight of 470.28 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichloro-1,2-thiazole-5-carbonyl chloride;molecular iodine is sourced from PubChem (CID 160689562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).