About 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine
2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine (PubChem CID 160689953) has the molecular formula C8H13Br3Cl2O2
and a molecular weight of 451.81 g/mol. Its IUPAC name is 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine.
Molecular Properties
| Compound Name | 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine |
| PubChem CID | 160689953 |
| Molecular Formula | C8H13Br3Cl2O2 |
| Molecular Weight | 451.81 g/mol |
| Exact Mass | 447.78 |
| IUPAC Name | 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine |
| SMILES | BrBr.O=CC(Br)CCCl.O=CCCCCl |
| InChI | InChI=1S/C4H6BrClO.C4H7ClO.Br2/c5-4(3-7)1-2-6;5-3-1-2-4-6;1-2/h3-4H,1-2H2;4H,1-3H2; |
| InChIKey | RPGVLVRFIMTBSJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.81 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine?
The IUPAC name of 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine (CID 160689953) is 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine.
What is the SMILES notation for 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine?
The canonical SMILES for 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine is BrBr.O=CC(Br)CCCl.O=CCCCCl.
What is the InChIKey of 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine?
The InChIKey is RPGVLVRFIMTBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BrClO.C4H7ClO.Br2/c5-4(3-7)1-2-6;5-3-1-2-4-6;1-2/h3-4H,1-2H2;4H,1-3H2;.
What are the key properties of 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine?
2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine has a molecular weight of 451.81 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-chlorobutanal;4-chlorobutanal;molecular bromine is sourced from PubChem (CID 160689953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).