C20H15F6NO3S — CID 160690203
benzene;2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)-N-methylbenzenesulfonamide (PubChem CID 160690203) has the molecular formula C20H15F6NO3S and a molecular weight of 463.40 g/mol. Its IUPAC name is benzene;2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)-N-methylbenzenesulfonamide.
| Compound Name | benzene;2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 160690203 |
| Molecular Formula | C20H15F6NO3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | benzene;2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1F.c1ccccc1 |
| InChI | InChI=1S/C14H9F6NO3S.C6H6/c1-21(6-3-4-8(24-2)7(15)5-6)25(22,23)14-12(19)10(17)9(16)11(18)13(14)20;1-2-4-6-5-3-1/h3-5H,1-2H3;1-6H |
| InChIKey | RPHQFRPNLZOZMT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|