C22H23N5O4S — CID 160693634
2-[(8R)-3'-amino-2'-methyl-1',1'-dioxospiro[6,7-dihydro-5H-naphthalene-8,5'-6H-1,2,4-thiadiazine]-2-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone (PubChem CID 160693634) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is 2-[(8R)-3'-amino-2'-methyl-1',1'-dioxospiro[6,7-dihydro-5H-naphthalene-8,5'-6H-1,2,4-thiadiazine]-2-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[(8R)-3'-amino-2'-methyl-1',1'-dioxospiro[6,7-dihydro-5H-naphthalene-8,5'-6H-1,2,4-thiadiazine]-2-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 160693634 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[(8R)-3'-amino-2'-methyl-1',1'-dioxospiro[6,7-dihydro-5H-naphthalene-8,5'-6H-1,2,4-thiadiazine]-2-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
| SMILES | C#CCOc1cnc(C(=O)Cc2ccc3c(c2)[C@]2(CCC3)CS(=O)(=O)N(C)C(N)=N2)cn1 |
| InChI | InChI=1S/C22H23N5O4S/c1-3-9-31-20-13-24-18(12-25-20)19(28)11-15-6-7-16-5-4-8-22(17(16)10-15)14-32(29,30)27(2)21(23)26-22/h1,6-7,10,12-13H,4-5,8-9,11,14H2,2H3,(H2,23,26)/t22-/m0/s1 |
| InChIKey | VGDLHXQEJVGBKO-QFIPXVFZSA-N |
| XLogP | 1.04 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|