C36H32N6O3 — CID 160695071
but-2-ynoic acid;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline;N-[3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide (PubChem CID 160695071) has the molecular formula C36H32N6O3 and a molecular weight of 596.69 g/mol. Its IUPAC name is but-2-ynoic acid;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline;N-[3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide.
| Compound Name | but-2-ynoic acid;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline;N-[3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide |
|---|---|
| PubChem CID | 160695071 |
| Molecular Formula | C36H32N6O3 |
| Molecular Weight | 596.69 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | but-2-ynoic acid;3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)aniline;N-[3-(3-methyl-1H-pyrrolo[2,3-b]pyridin-5-yl)phenyl]but-2-ynamide |
| SMILES | CC#CC(=O)Nc1cccc(-c2cnc3[nH]cc(C)c3c2)c1.CC#CC(=O)O.Cc1c[nH]c2ncc(-c3cccc(N)c3)cc12 |
| InChI | InChI=1S/C18H15N3O.C14H13N3.C4H4O2/c1-3-5-17(22)21-15-7-4-6-13(8-15)14-9-16-12(2)10-19-18(16)20-11-14;1-9-7-16-14-13(9)6-11(8-17-14)10-3-2-4-12(15)5-10;1-2-3-4(5)6/h4,6-11H,1-2H3,(H,19,20)(H,21,22);2-8H,15H2,1H3,(H,16,17);1H3,(H,5,6) |
| InChIKey | RPWUMPTVPWYQMX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.69 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|