C27H30N6 — CID 160696835
4,5,6,7-tetramethyl-2H-benzimidazole;4,5,9,10-tetramethyl-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole (PubChem CID 160696835) has the molecular formula C27H30N6 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-2H-benzimidazole;4,5,9,10-tetramethyl-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole.
| Compound Name | 4,5,6,7-tetramethyl-2H-benzimidazole;4,5,9,10-tetramethyl-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
|---|---|
| PubChem CID | 160696835 |
| Molecular Formula | C27H30N6 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 4,5,6,7-tetramethyl-2H-benzimidazole;4,5,9,10-tetramethyl-2,7-dihydrobenzimidazolo[5,4-e]benzimidazole |
| SMILES | Cc1c(C)c(C)c2c(c1C)=NCN=2.Cc1c(C)c2c3c(c(C)c(C)c2c2c1=NCN=2)=NCN=3 |
| InChI | InChI=1S/C16H16N4.C11H14N2/c1-7-9(3)13-16(20-5-17-13)12-8(2)10(4)14-15(11(7)12)19-6-18-14;1-6-7(2)9(4)11-10(8(6)3)12-5-13-11/h5-6H2,1-4H3;5H2,1-4H3 |
| InChIKey | RQCKBHFZGXWJOW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |