C25H30ClN3O10S4 — CID 160696895
4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-methyl-5-methylsulfonylbenzoyl chloride (PubChem CID 160696895) has the molecular formula C25H30ClN3O10S4 and a molecular weight of 696.25 g/mol. Its IUPAC name is 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-methyl-5-methylsulfonylbenzoyl chloride.
| Compound Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-methyl-5-methylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 160696895 |
| Molecular Formula | C25H30ClN3O10S4 |
| Molecular Weight | 696.25 g/mol |
| Exact Mass | 695.05 |
| IUPAC Name | 4-cyclopropylsulfonyl-N-(diaminomethylidene)-2-methyl-5-methylsulfonylbenzamide;4-cyclopropylsulfonyl-2-methyl-5-methylsulfonylbenzoyl chloride |
| SMILES | Cc1cc(S(=O)(=O)C2CC2)c(S(C)(=O)=O)cc1C(=O)Cl.Cc1cc(S(=O)(=O)C2CC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C13H17N3O5S2.C12H13ClO5S2/c1-7-5-11(23(20,21)8-3-4-8)10(22(2,18)19)6-9(7)12(17)16-13(14)15;1-7-5-11(20(17,18)8-3-4-8)10(19(2,15)16)6-9(7)12(13)14/h5-6,8H,3-4H2,1-2H3,(H4,14,15,16,17);5-6,8H,3-4H2,1-2H3 |
| InChIKey | RQCOOXOPJYCLHX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 235.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|