C21H22ClF3N2O3S — CID 160699594
4-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]-1-pyridin-4-ylbutan-1-one;2,2,2-trifluoroacetic acid (PubChem CID 160699594) has the molecular formula C21H22ClF3N2O3S and a molecular weight of 474.93 g/mol. Its IUPAC name is 4-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]-1-pyridin-4-ylbutan-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]-1-pyridin-4-ylbutan-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160699594 |
| Molecular Formula | C21H22ClF3N2O3S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)sulfanyl]-1-pyridin-4-ylbutan-1-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CCCSc1c(Cl)ccc2c1CCNCC2)c1ccncc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21ClN2OS.C2HF3O2/c20-17-4-3-14-5-9-22-12-8-16(14)19(17)24-13-1-2-18(23)15-6-10-21-11-7-15;3-2(4,5)1(6)7/h3-4,6-7,10-11,22H,1-2,5,8-9,12-13H2;(H,6,7) |
| InChIKey | UGHULCDHGZQMCC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|