C23H26N2O4 — CID 160699602
(E)-1-hydroxy-4-[2-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]but-3-en-2-one (PubChem CID 160699602) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is (E)-1-hydroxy-4-[2-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]but-3-en-2-one.
| Compound Name | (E)-1-hydroxy-4-[2-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 160699602 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | (E)-1-hydroxy-4-[2-[4-[2-(4-methoxyphenyl)acetyl]piperazin-1-yl]phenyl]but-3-en-2-one |
| SMILES | COc1ccc(CC(=O)N2CCN(c3ccccc3/C=C/C(=O)CO)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-29-21-10-6-18(7-11-21)16-23(28)25-14-12-24(13-15-25)22-5-3-2-4-19(22)8-9-20(27)17-26/h2-11,26H,12-17H2,1H3/b9-8+ |
| InChIKey | RQLGGVBZNALLKR-CMDGGOBGSA-N |
| XLogP | 2.16 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|