C13H26F5N — CID 160700488
decan-1-amine;1,1,1,3,3-pentafluoropropane (PubChem CID 160700488) has the molecular formula C13H26F5N and a molecular weight of 291.35 g/mol. Its IUPAC name is decan-1-amine;1,1,1,3,3-pentafluoropropane.
| Compound Name | decan-1-amine;1,1,1,3,3-pentafluoropropane |
|---|---|
| PubChem CID | 160700488 |
| Molecular Formula | C13H26F5N |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | decan-1-amine;1,1,1,3,3-pentafluoropropane |
| SMILES | CCCCCCCCCCN.FC(F)CC(F)(F)F |
| InChI | InChI=1S/C10H23N.C3H3F5/c1-2-3-4-5-6-7-8-9-10-11;4-2(5)1-3(6,7)8/h2-11H2,1H3;2H,1H2 |
| InChIKey | RQOBBVZRHWENJY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|