C31H58O2Si2 — CID 160700868
(1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]nona-1,7-dien-4-ol (PubChem CID 160700868) has the molecular formula C31H58O2Si2 and a molecular weight of 518.98 g/mol. Its IUPAC name is (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]nona-1,7-dien-4-ol.
| Compound Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]nona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 160700868 |
| Molecular Formula | C31H58O2Si2 |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.40 |
| IUPAC Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2R)-2-[2-tri(propan-2-yl)silylethynyl]cyclopropyl]nona-1,7-dien-4-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H](O)C/C=C\[C@H]1C[C@H]1C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H58O2Si2/c1-15-17-29(33-34(13,14)30(8,9)10)31(11,12)28(32)19-16-18-26-22-27(26)20-21-35(23(2)3,24(4)5)25(6)7/h15-18,23-29,32H,19,22H2,1-14H3/b17-15+,18-16-/t26-,27+,28-,29-/m0/s1 |
| InChIKey | RQPCFSLJDNRIKI-MXDMYINMSA-N |
| XLogP | 9.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|