About 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate
1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate (PubChem CID 160701489) has the molecular formula C16H21IN2O2
and a molecular weight of 403.27 g/mol. Its IUPAC name is 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate.
Molecular Properties
| Compound Name | 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate |
| PubChem CID | 160701489 |
| Molecular Formula | C16H21IN2O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate |
| SMILES | CC(C)(N=C=O)c1cccc(C(C)(C)OC#N)c1.[2H]C(I)C[3H] |
| InChI | InChI=1S/C14H16N2O2.C2H5I/c1-13(2,16-10-17)11-6-5-7-12(8-11)14(3,4)18-9-15;1-2-3/h5-8H,1-4H3;2H2,1H3/i;1T,2D |
| InChIKey | RQRDGQJSQZLZOP-AIUOOXLKSA-N |
| XLogP | 4.43 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate?
The IUPAC name of 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate (CID 160701489) is 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate.
What is the SMILES notation for 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate?
The canonical SMILES for 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate is CC(C)(N=C=O)c1cccc(C(C)(C)OC#N)c1.[2H]C(I)C[3H].
What is the InChIKey of 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate?
The InChIKey is RQRDGQJSQZLZOP-AIUOOXLKSA-N. The full InChI is InChI=1S/C14H16N2O2.C2H5I/c1-13(2,16-10-17)11-6-5-7-12(8-11)14(3,4)18-9-15;1-2-3/h5-8H,1-4H3;2H2,1H3/i;1T,2D.
What are the key properties of 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate?
1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate has a molecular weight of 403.27 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-1-iodo-2-tritioethane;2-[3-(2-isocyanatopropan-2-yl)phenyl]propan-2-yl cyanate is sourced from PubChem (CID 160701489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).