C19H21N5 — CID 160701841
2-pentyl-7-(2H-pyrrol-3-yl)pyrazolo[4,3-c]quinolin-4-amine (PubChem CID 160701841) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-pentyl-7-(2H-pyrrol-3-yl)pyrazolo[4,3-c]quinolin-4-amine.
| Compound Name | 2-pentyl-7-(2H-pyrrol-3-yl)pyrazolo[4,3-c]quinolin-4-amine |
|---|---|
| PubChem CID | 160701841 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-pentyl-7-(2H-pyrrol-3-yl)pyrazolo[4,3-c]quinolin-4-amine |
| SMILES | CCCCCn1cc2c(N)nc3cc(C4=CC=NC4)ccc3c2n1 |
| InChI | InChI=1S/C19H21N5/c1-2-3-4-9-24-12-16-18(23-24)15-6-5-13(14-7-8-21-11-14)10-17(15)22-19(16)20/h5-8,10,12H,2-4,9,11H2,1H3,(H2,20,22) |
| InChIKey | RQSIBTGDNYJUSZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|