About 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium
5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium (PubChem CID 160701874) has the molecular formula C14H10BrF3NY-
and a molecular weight of 418.05 g/mol. Its IUPAC name is 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium.
Molecular Properties
| Compound Name | 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium |
| PubChem CID | 160701874 |
| Molecular Formula | C14H10BrF3NY- |
| Molecular Weight | 418.05 g/mol |
| Exact Mass | 416.90 |
| IUPAC Name | 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(Br)=C[C-]=C(c2c(F)cc(F)cc2F)N1CC.[Y] |
| InChI | InChI=1S/C14H10BrF3N.Y/c1-3-19-8(2)10(15)4-5-13(19)14-11(17)6-9(16)7-12(14)18;/h4,6-7H,2-3H2,1H3;/q-1; |
| InChIKey | HROLFDQJTIBJQV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.05 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium?
The IUPAC name of 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium (CID 160701874) is 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium.
What is the SMILES notation for 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium?
The canonical SMILES for 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium is C=C1C(Br)=C[C-]=C(c2c(F)cc(F)cc2F)N1CC.[Y].
What is the InChIKey of 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium?
The InChIKey is HROLFDQJTIBJQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF3N.Y/c1-3-19-8(2)10(15)4-5-13(19)14-11(17)6-9(16)7-12(14)18;/h4,6-7H,2-3H2,1H3;/q-1;.
What are the key properties of 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium?
5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium has a molecular weight of 418.05 g/mol, XLogP of 4.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-ethyl-6-methylidene-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-ide;yttrium is sourced from PubChem (CID 160701874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).