About 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide
2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide (PubChem CID 160701946) has the molecular formula C22H28O2S3
and a molecular weight of 420.67 g/mol. Its IUPAC name is 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide |
| PubChem CID | 160701946 |
| Molecular Formula | C22H28O2S3 |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide |
| SMILES | CC1CCCS1(=O)=O.Cc1ccc(-c2ccccc2)s1.Cc1csc(C)c1 |
| InChI | InChI=1S/C11H10S.C6H8S.C5H10O2S/c1-9-7-8-11(12-9)10-5-3-2-4-6-10;1-5-3-6(2)7-4-5;1-5-3-2-4-8(5,6)7/h2-8H,1H3;3-4H,1-2H3;5H,2-4H2,1H3 |
| InChIKey | RQSQKGYJXBNVFB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide?
The IUPAC name of 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide (CID 160701946) is 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide.
What is the SMILES notation for 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide?
The canonical SMILES for 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide is CC1CCCS1(=O)=O.Cc1ccc(-c2ccccc2)s1.Cc1csc(C)c1.
What is the InChIKey of 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide?
The InChIKey is RQSQKGYJXBNVFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S.C6H8S.C5H10O2S/c1-9-7-8-11(12-9)10-5-3-2-4-6-10;1-5-3-6(2)7-4-5;1-5-3-2-4-8(5,6)7/h2-8H,1H3;3-4H,1-2H3;5H,2-4H2,1H3.
What are the key properties of 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide?
2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide has a molecular weight of 420.67 g/mol, XLogP of 6.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylthiophene;2-methyl-5-phenylthiophene;2-methylthiolane 1,1-dioxide is sourced from PubChem (CID 160701946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).