About acetonitrile;N,N-dimethylaniline;pyrene
acetonitrile;N,N-dimethylaniline;pyrene (PubChem CID 160703197) has the molecular formula C26H24N2
and a molecular weight of 364.49 g/mol. Its IUPAC name is acetonitrile;N,N-dimethylaniline;pyrene.
Molecular Properties
| Compound Name | acetonitrile;N,N-dimethylaniline;pyrene |
| PubChem CID | 160703197 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | acetonitrile;N,N-dimethylaniline;pyrene |
| SMILES | CC#N.CN(C)c1ccccc1.c1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H10.C8H11N.C2H3N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-9(2)8-6-4-3-5-7-8;1-2-3/h1-10H;3-7H,1-2H3;1H3 |
| InChIKey | RQWRNZUHVPHHIO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;N,N-dimethylaniline;pyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N,N-dimethylaniline;pyrene?
The IUPAC name of acetonitrile;N,N-dimethylaniline;pyrene (CID 160703197) is acetonitrile;N,N-dimethylaniline;pyrene.
What is the SMILES notation for acetonitrile;N,N-dimethylaniline;pyrene?
The canonical SMILES for acetonitrile;N,N-dimethylaniline;pyrene is CC#N.CN(C)c1ccccc1.c1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of acetonitrile;N,N-dimethylaniline;pyrene?
The InChIKey is RQWRNZUHVPHHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10.C8H11N.C2H3N/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14;1-9(2)8-6-4-3-5-7-8;1-2-3/h1-10H;3-7H,1-2H3;1H3.
What are the key properties of acetonitrile;N,N-dimethylaniline;pyrene?
acetonitrile;N,N-dimethylaniline;pyrene has a molecular weight of 364.49 g/mol, XLogP of 6.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N,N-dimethylaniline;pyrene is sourced from PubChem (CID 160703197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).