About 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile
3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile (PubChem CID 160704289) has the molecular formula C24H16BBrF2N4O2
and a molecular weight of 521.13 g/mol. Its IUPAC name is 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile.
Molecular Properties
| Compound Name | 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile |
| PubChem CID | 160704289 |
| Molecular Formula | C24H16BBrF2N4O2 |
| Molecular Weight | 521.13 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile |
| SMILES | Brc1cccnc1.N#Cc1ccc(-c2cccnc2)cc1F.N#Cc1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C12H7FN2.C7H5BFNO2.C5H4BrN/c13-12-6-9(3-4-10(12)7-14)11-2-1-5-15-8-11;9-7-3-6(8(11)12)2-1-5(7)4-10;6-5-2-1-3-7-4-5/h1-6,8H;1-3,11-12H;1-4H |
| InChIKey | RRADSGMSQNJQNN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile?
The IUPAC name of 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile (CID 160704289) is 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile.
What is the SMILES notation for 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile?
The canonical SMILES for 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile is Brc1cccnc1.N#Cc1ccc(-c2cccnc2)cc1F.N#Cc1ccc(B(O)O)cc1F.
What is the InChIKey of 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile?
The InChIKey is RRADSGMSQNJQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FN2.C7H5BFNO2.C5H4BrN/c13-12-6-9(3-4-10(12)7-14)11-2-1-5-15-8-11;9-7-3-6(8(11)12)2-1-5(7)4-10;6-5-2-1-3-7-4-5/h1-6,8H;1-3,11-12H;1-4H.
What are the key properties of 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile?
3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile has a molecular weight of 521.13 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine;(4-cyano-3-fluorophenyl)boronic acid;2-fluoro-4-pyridin-3-ylbenzonitrile is sourced from PubChem (CID 160704289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).