C22H27N3O — CID 160704557
methane;2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-pyridin-4-ylethanol (PubChem CID 160704557) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is methane;2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-pyridin-4-ylethanol.
| Compound Name | methane;2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-pyridin-4-ylethanol |
|---|---|
| PubChem CID | 160704557 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | methane;2-(5-methyl-9,12-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-1-pyridin-4-ylethanol |
| SMILES | C.Cc1ccc2c(c1)c1c(n2CC(O)c2ccncc2)CN2CCC1C2 |
| InChI | InChI=1S/C21H23N3O.CH4/c1-14-2-3-18-17(10-14)21-16-6-9-23(11-16)12-19(21)24(18)13-20(25)15-4-7-22-8-5-15;/h2-5,7-8,10,16,20,25H,6,9,11-13H2,1H3;1H4 |
| InChIKey | RRAZXWYEBHGCCZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|