C20H29ClN8O8 — CID 160704976
2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one;4-methyl-2-(3-methylmorpholin-4-yl)-5-nitro-1H-pyrimidin-6-one;(3S)-3-methylmorpholine (PubChem CID 160704976) has the molecular formula C20H29ClN8O8 and a molecular weight of 544.95 g/mol. Its IUPAC name is 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one;4-methyl-2-(3-methylmorpholin-4-yl)-5-nitro-1H-pyrimidin-6-one;(3S)-3-methylmorpholine.
| Compound Name | 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one;4-methyl-2-(3-methylmorpholin-4-yl)-5-nitro-1H-pyrimidin-6-one;(3S)-3-methylmorpholine |
|---|---|
| PubChem CID | 160704976 |
| Molecular Formula | C20H29ClN8O8 |
| Molecular Weight | 544.95 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-chloro-4-methyl-5-nitro-1H-pyrimidin-6-one;4-methyl-2-(3-methylmorpholin-4-yl)-5-nitro-1H-pyrimidin-6-one;(3S)-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1.Cc1nc(Cl)[nH]c(=O)c1[N+](=O)[O-].Cc1nc(N2CCOCC2C)[nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N4O4.C5H4ClN3O3.C5H11NO/c1-6-5-18-4-3-13(6)10-11-7(2)8(14(16)17)9(15)12-10;1-2-3(9(11)12)4(10)8-5(6)7-2;1-5-4-7-3-2-6-5/h6H,3-5H2,1-2H3,(H,11,12,15);1H3,(H,7,8,10);5-6H,2-4H2,1H3/t;;5-/m..0/s1 |
| InChIKey | RRCKHARXXKMZRQ-BYOYUIHVSA-N |
| XLogP | 0.85 |
| TPSA | 211.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.95 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|