About acetyl-methyl-oxophosphanium;methane
acetyl-methyl-oxophosphanium;methane (PubChem CID 160705504) has the molecular formula C5H14O2P+
and a molecular weight of 137.14 g/mol. Its IUPAC name is acetyl-methyl-oxophosphanium;methane.
Molecular Properties
| Compound Name | acetyl-methyl-oxophosphanium;methane |
| PubChem CID | 160705504 |
| Molecular Formula | C5H14O2P+ |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | acetyl-methyl-oxophosphanium;methane |
| SMILES | C.C.CC(=O)[P+](C)=O |
| InChI | InChI=1S/C3H6O2P.2CH4/c1-3(4)6(2)5;;/h1-2H3;2*1H4/q+1;; |
| InChIKey | RHIGBYQGWDIXBO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetyl-methyl-oxophosphanium;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl-methyl-oxophosphanium;methane?
The IUPAC name of acetyl-methyl-oxophosphanium;methane (CID 160705504) is acetyl-methyl-oxophosphanium;methane.
What is the SMILES notation for acetyl-methyl-oxophosphanium;methane?
The canonical SMILES for acetyl-methyl-oxophosphanium;methane is C.C.CC(=O)[P+](C)=O.
What is the InChIKey of acetyl-methyl-oxophosphanium;methane?
The InChIKey is RHIGBYQGWDIXBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2P.2CH4/c1-3(4)6(2)5;;/h1-2H3;2*1H4/q+1;;.
What are the key properties of acetyl-methyl-oxophosphanium;methane?
acetyl-methyl-oxophosphanium;methane has a molecular weight of 137.14 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl-methyl-oxophosphanium;methane is sourced from PubChem (CID 160705504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).