About 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid
3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid (PubChem CID 160707862) has the molecular formula C20H16O6
and a molecular weight of 352.34 g/mol. Its IUPAC name is 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid.
Molecular Properties
| Compound Name | 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid |
| PubChem CID | 160707862 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid |
| SMILES | O=C(O)c1cccc(OC2(Oc3cccc(C(=O)O)c3)C=CC=CC2)c1 |
| InChI | InChI=1S/C20H16O6/c21-18(22)14-6-4-8-16(12-14)25-20(10-2-1-3-11-20)26-17-9-5-7-15(13-17)19(23)24/h1-10,12-13H,11H2,(H,21,22)(H,23,24) |
| InChIKey | RRLSATUZZUKXEF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid?
The IUPAC name of 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid (CID 160707862) is 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid.
What is the SMILES notation for 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid?
The canonical SMILES for 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid is O=C(O)c1cccc(OC2(Oc3cccc(C(=O)O)c3)C=CC=CC2)c1.
What is the InChIKey of 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid?
The InChIKey is RRLSATUZZUKXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O6/c21-18(22)14-6-4-8-16(12-14)25-20(10-2-1-3-11-20)26-17-9-5-7-15(13-17)19(23)24/h1-10,12-13H,11H2,(H,21,22)(H,23,24).
What are the key properties of 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid?
3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid has a molecular weight of 352.34 g/mol, XLogP of 3.75, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-carboxyphenoxy)cyclohexa-2,4-dien-1-yl]oxybenzoic acid is sourced from PubChem (CID 160707862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).